Jump to content
Wikipedia The Free Encyclopedia

Tectorigenin: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
OAbot (talk | contribs)
447,677 edits
m Open access bot: doi updated in citation with #oabot.
Citation bot (talk | contribs)
5,553,051 edits
Removed parameters. | Use this bot. Report bugs. | Suggested by Neko-chan | Category:CS1 maint: DOI inactive as of February 2024‎ | #UCB_Category 208/293
Line 50: Line 50:
}}
}}


'''Tectorigenin''' is an [[O-methylated isoflavone|''O''-methylated isoflavone]], a type of flavonoid. It ha been isolated from [[Belamcanda chinensis|leopard lily]] (''Belamcanda chinensis''),<ref>{{cite journal | doi = 10.1093/carcin/bgi092 | title = Tectorigenin and other phytochemicals extracted from leopard lily Belamcanda chinensis affect new and established targets for therapies in prostate cancer | date = 2005 | last1 = Thelen | first1 = Paul | last2 = Scharf | first2 = Jens-Gerd | last3 = Burfeind | first3 = Peter | last4 = Hemmerlein | first4 = Bernhard | last5 = Wuttke | first5 = Wolfgang | last6 = Spengler | first6 = Barbara | last7 = Christoffel | first7 = Volker | last8 = Ringert | first8 = Rolf-Hermann | last9 = Seidlová-Wuttke | first9 = Dana | journal = Carcinogenesis | volume = 26 | issue = 8 | pages = 1360–1367 | pmid = 15845653 | doi-access = free }}</ref> [[Iris unguicularis|Algerian iris]] (''Iris unguicularis'')<ref>{{cite journal | doi = 10.3987/COM-10-S(E)6 | title = New and Known Constituents from Iris unguicularis and Their Antioxidant Activity | date = 2010 | last1 = Atta-Ur-Rahman | last2 = Hareem | first2 = Sumaira | last3 = Iqbal Choudhary | first3 = M. | last4 = Sener | first4 = Bilge | last5 = Abbaskhan | first5 = Ahmed | last6 = Siddiqui | first6 = Hina | last7 = Anjum | first7 = Shazia | last8 = Orhan | first8 = Ilkay | last9 = Gurbuz | first9 = Ilhan | last10 = Ayanoglu | first10 = Filiz | journal = Heterocycles | volume = 82 | page = 813(削除) | doi-broken-date = 2024年02月11日 (削除ここまで) | doi-access = free }}</ref> and [[Pueraria thunbergiana|East Asian arrowroot]] (''Pueraria thunbergiana'').<ref>{{cite journal | doi = 10.1248/bpb.24.1117 | title = Tectorigenin, an Isoflavone of Pueraria thunbergiana BENTH., Induces Differentiation and Apoptosis in Human Promyelocytic Leukemia HL-60 Cells | date = 2001 | last1 = Lee | first1 = Kyung-Tae | last2 = Sohn | first2 = Il-Cheol | last3 = Kim | first3 = Young-Kwan | last4 = Choi | first4 = Jung-Hye | last5 = Choi | first5 = Jong-Won | last6 = Park | first6 = Hee-Juhn | last7 = Itoh | first7 = Yoshie | last8 = Miyamoto | first8 = Ken-Ichi | journal = Biological and Pharmaceutical Bulletin | volume = 24 | issue = 10 | pages = 1117–1121 | pmid = 11642314 | doi-access = free }}</ref>
'''Tectorigenin''' is an [[O-methylated isoflavone|''O''-methylated isoflavone]], a type of flavonoid. It ha been isolated from [[Belamcanda chinensis|leopard lily]] (''Belamcanda chinensis''),<ref>{{cite journal | doi = 10.1093/carcin/bgi092 | title = Tectorigenin and other phytochemicals extracted from leopard lily Belamcanda chinensis affect new and established targets for therapies in prostate cancer | date = 2005 | last1 = Thelen | first1 = Paul | last2 = Scharf | first2 = Jens-Gerd | last3 = Burfeind | first3 = Peter | last4 = Hemmerlein | first4 = Bernhard | last5 = Wuttke | first5 = Wolfgang | last6 = Spengler | first6 = Barbara | last7 = Christoffel | first7 = Volker | last8 = Ringert | first8 = Rolf-Hermann | last9 = Seidlová-Wuttke | first9 = Dana | journal = Carcinogenesis | volume = 26 | issue = 8 | pages = 1360–1367 | pmid = 15845653 | doi-access = free }}</ref> [[Iris unguicularis|Algerian iris]] (''Iris unguicularis'')<ref>{{cite journal | doi = 10.3987/COM-10-S(E)6 | title = New and Known Constituents from Iris unguicularis and Their Antioxidant Activity | date = 2010 | last1 = Atta-Ur-Rahman | last2 = Hareem | first2 = Sumaira | last3 = Iqbal Choudhary | first3 = M. | last4 = Sener | first4 = Bilge | last5 = Abbaskhan | first5 = Ahmed | last6 = Siddiqui | first6 = Hina | last7 = Anjum | first7 = Shazia | last8 = Orhan | first8 = Ilkay | last9 = Gurbuz | first9 = Ilhan | last10 = Ayanoglu | first10 = Filiz | journal = Heterocycles | volume = 82 | page = 813 | doi-access = free }}</ref> and [[Pueraria thunbergiana|East Asian arrowroot]] (''Pueraria thunbergiana'').<ref>{{cite journal | doi = 10.1248/bpb.24.1117 | title = Tectorigenin, an Isoflavone of Pueraria thunbergiana BENTH., Induces Differentiation and Apoptosis in Human Promyelocytic Leukemia HL-60 Cells | date = 2001 | last1 = Lee | first1 = Kyung-Tae | last2 = Sohn | first2 = Il-Cheol | last3 = Kim | first3 = Young-Kwan | last4 = Choi | first4 = Jung-Hye | last5 = Choi | first5 = Jong-Won | last6 = Park | first6 = Hee-Juhn | last7 = Itoh | first7 = Yoshie | last8 = Miyamoto | first8 = Ken-Ichi | journal = Biological and Pharmaceutical Bulletin | volume = 24 | issue = 10 | pages = 1117–1121 | pmid = 11642314 | doi-access = free }}</ref>


== Glycosides ==
== Glycosides ==

Latest revision as of 01:12, 18 September 2024

Tectorigenin
Tectorigenin molecule
Names
IUPAC name
4′,5,7-Trihydroxy-6-methoxyisoflavone
Systematic IUPAC name
5,7-Dihydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
Other names
Tectorigenine
Identifiers
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
ECHA InfoCard 100.208.621 Edit this at Wikidata
KEGG
UNII
  • InChI=1S/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 N
    Key: OBBCRPUNCUPUOS-UHFFFAOYSA-N N
  • InChI=1/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3
    Key: OBBCRPUNCUPUOS-UHFFFAOYAZ
  • COC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC=C(C=C3)O)O
Properties
C16H12O6
Molar mass 300.266 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
N verify  (what is checkYN ?)
Chemical compound

Tectorigenin is an O-methylated isoflavone, a type of flavonoid. It ha been isolated from leopard lily (Belamcanda chinensis),[1] Algerian iris (Iris unguicularis)[2] and East Asian arrowroot (Pueraria thunbergiana).[3]

Glycosides

[edit ]

Tectoridin is the 7-glucoside of tectorigenin.

See also

[edit ]

References

[edit ]
  1. ^ Thelen, Paul; Scharf, Jens-Gerd; Burfeind, Peter; Hemmerlein, Bernhard; Wuttke, Wolfgang; Spengler, Barbara; Christoffel, Volker; Ringert, Rolf-Hermann; Seidlová-Wuttke, Dana (2005). "Tectorigenin and other phytochemicals extracted from leopard lily Belamcanda chinensis affect new and established targets for therapies in prostate cancer". Carcinogenesis. 26 (8): 1360–1367. doi:10.1093/carcin/bgi092 . PMID 15845653.
  2. ^ Atta-Ur-Rahman; Hareem, Sumaira; Iqbal Choudhary, M.; Sener, Bilge; Abbaskhan, Ahmed; Siddiqui, Hina; Anjum, Shazia; Orhan, Ilkay; Gurbuz, Ilhan; Ayanoglu, Filiz (2010). "New and Known Constituents from Iris unguicularis and Their Antioxidant Activity". Heterocycles. 82: 813. doi:10.3987/COM-10-S(E)6 .
  3. ^ Lee, Kyung-Tae; Sohn, Il-Cheol; Kim, Young-Kwan; Choi, Jung-Hye; Choi, Jong-Won; Park, Hee-Juhn; Itoh, Yoshie; Miyamoto, Ken-Ichi (2001). "Tectorigenin, an Isoflavone of Pueraria thunbergiana BENTH., Induces Differentiation and Apoptosis in Human Promyelocytic Leukemia HL-60 Cells". Biological and Pharmaceutical Bulletin. 24 (10): 1117–1121. doi:10.1248/bpb.24.1117 . PMID 11642314.
Stub icon

This article about an aromatic compound is a stub. You can help Wikipedia by expanding it.

AltStyle によって変換されたページ (->オリジナル) /